C15H24N4O2 — CID 81107942
(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-(5-propyl-1H-1,2,4-triazol-3-yl)methanone (PubChem CID 81107942) has the molecular formula C15H24N4O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is (4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-(5-propyl-1H-1,2,4-triazol-3-yl)methanone.
| Compound Name | (4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-(5-propyl-1H-1,2,4-triazol-3-yl)methanone |
|---|---|
| PubChem CID | 81107942 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | (4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-(5-propyl-1H-1,2,4-triazol-3-yl)methanone |
| SMILES | CCCc1nc(C(=O)N2CCC3(O)CCCCC3C2)n[nH]1 |
| InChI | InChI=1S/C15H24N4O2/c1-2-5-12-16-13(18-17-12)14(20)19-9-8-15(21)7-4-3-6-11(15)10-19/h11,21H,2-10H2,1H3,(H,16,17,18) |
| InChIKey | CPPLLDMPUZBPLO-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |