C15H22N2O — CID 81108121
5-(cyclohexylamino)-5,6,7,8-tetrahydro-1H-quinolin-2-one (PubChem CID 81108121) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is 5-(cyclohexylamino)-5,6,7,8-tetrahydro-1H-quinolin-2-one.
| Compound Name | 5-(cyclohexylamino)-5,6,7,8-tetrahydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 81108121 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 5-(cyclohexylamino)-5,6,7,8-tetrahydro-1H-quinolin-2-one |
| SMILES | O=c1ccc2c([nH]1)CCCC2NC1CCCCC1 |
| InChI | InChI=1S/C15H22N2O/c18-15-10-9-12-13(7-4-8-14(12)17-15)16-11-5-2-1-3-6-11/h9-11,13,16H,1-8H2,(H,17,18) |
| InChIKey | HNTUCJQAPIYMCB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |