C14H22N2O4S — CID 81108217
(4R)-3-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carbonyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 81108217) has the molecular formula C14H22N2O4S and a molecular weight of 314.41 g/mol. Its IUPAC name is (4R)-3-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carbonyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (4R)-3-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carbonyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 81108217 |
| Molecular Formula | C14H22N2O4S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | (4R)-3-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carbonyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CSCN1C(=O)N1CCC2(O)CCCCC2C1 |
| InChI | InChI=1S/C14H22N2O4S/c17-12(18)11-8-21-9-16(11)13(19)15-6-5-14(20)4-2-1-3-10(14)7-15/h10-11,20H,1-9H2,(H,17,18)/t10?,11-,14?/m0/s1 |
| InChIKey | UXWZRQQCSXGRST-CVZZAPKMSA-N |
| XLogP | 1.19 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |