About 1-(4-amino-6-propoxy-1,3,5-triazin-2-yl)-4-methylpiperidin-4-ol
1-(4-amino-6-propoxy-1,3,5-triazin-2-yl)-4-methylpiperidin-4-ol (PubChem CID 81108978) has the molecular formula C12H21N5O2
and a molecular weight of 267.33 g/mol. Its IUPAC name is 1-(4-amino-6-propoxy-1,3,5-triazin-2-yl)-4-methylpiperidin-4-ol.
Molecular Properties
| Compound Name | 1-(4-amino-6-propoxy-1,3,5-triazin-2-yl)-4-methylpiperidin-4-ol |
| PubChem CID | 81108978 |
| Molecular Formula | C12H21N5O2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 1-(4-amino-6-propoxy-1,3,5-triazin-2-yl)-4-methylpiperidin-4-ol |
| SMILES | CCCOc1nc(N)nc(N2CCC(C)(O)CC2)n1 |
| InChI | InChI=1S/C12H21N5O2/c1-3-8-19-11-15-9(13)14-10(16-11)17-6-4-12(2,18)5-7-17/h18H,3-8H2,1-2H3,(H2,13,14,15,16) |
| InChIKey | HVDBIDRGKIJHEF-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-(4-amino-6-propoxy-1,3,5-triazin-2-yl)-4-methylpiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-amino-6-propoxy-1,3,5-triazin-2-yl)-4-methylpiperidin-4-ol?
The IUPAC name of 1-(4-amino-6-propoxy-1,3,5-triazin-2-yl)-4-methylpiperidin-4-ol (CID 81108978) is 1-(4-amino-6-propoxy-1,3,5-triazin-2-yl)-4-methylpiperidin-4-ol.
What is the SMILES notation for 1-(4-amino-6-propoxy-1,3,5-triazin-2-yl)-4-methylpiperidin-4-ol?
The canonical SMILES for 1-(4-amino-6-propoxy-1,3,5-triazin-2-yl)-4-methylpiperidin-4-ol is CCCOc1nc(N)nc(N2CCC(C)(O)CC2)n1.
What is the InChIKey of 1-(4-amino-6-propoxy-1,3,5-triazin-2-yl)-4-methylpiperidin-4-ol?
The InChIKey is HVDBIDRGKIJHEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N5O2/c1-3-8-19-11-15-9(13)14-10(16-11)17-6-4-12(2,18)5-7-17/h18H,3-8H2,1-2H3,(H2,13,14,15,16).
What are the key properties of 1-(4-amino-6-propoxy-1,3,5-triazin-2-yl)-4-methylpiperidin-4-ol?
1-(4-amino-6-propoxy-1,3,5-triazin-2-yl)-4-methylpiperidin-4-ol has a molecular weight of 267.33 g/mol, XLogP of 0.59, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-amino-6-propoxy-1,3,5-triazin-2-yl)-4-methylpiperidin-4-ol is sourced from PubChem (CID 81108978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).