About 2-(2,5-dioxo-7,8-dihydro-6H-quinolin-1-yl)-N-ethylacetamide
2-(2,5-dioxo-7,8-dihydro-6H-quinolin-1-yl)-N-ethylacetamide (PubChem CID 81109283) has the molecular formula C13H16N2O3
and a molecular weight of 248.28 g/mol. Its IUPAC name is 2-(2,5-dioxo-7,8-dihydro-6H-quinolin-1-yl)-N-ethylacetamide.
Molecular Properties
| Compound Name | 2-(2,5-dioxo-7,8-dihydro-6H-quinolin-1-yl)-N-ethylacetamide |
| PubChem CID | 81109283 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 2-(2,5-dioxo-7,8-dihydro-6H-quinolin-1-yl)-N-ethylacetamide |
| SMILES | CCNC(=O)Cn1c2c(ccc1=O)C(=O)CCC2 |
| InChI | InChI=1S/C13H16N2O3/c1-2-14-12(17)8-15-10-4-3-5-11(16)9(10)6-7-13(15)18/h6-7H,2-5,8H2,1H3,(H,14,17) |
| InChIKey | KDFNWHYDNVTULN-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2,5-dioxo-7,8-dihydro-6H-quinolin-1-yl)-N-ethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dioxo-7,8-dihydro-6H-quinolin-1-yl)-N-ethylacetamide?
The IUPAC name of 2-(2,5-dioxo-7,8-dihydro-6H-quinolin-1-yl)-N-ethylacetamide (CID 81109283) is 2-(2,5-dioxo-7,8-dihydro-6H-quinolin-1-yl)-N-ethylacetamide.
What is the SMILES notation for 2-(2,5-dioxo-7,8-dihydro-6H-quinolin-1-yl)-N-ethylacetamide?
The canonical SMILES for 2-(2,5-dioxo-7,8-dihydro-6H-quinolin-1-yl)-N-ethylacetamide is CCNC(=O)Cn1c2c(ccc1=O)C(=O)CCC2.
What is the InChIKey of 2-(2,5-dioxo-7,8-dihydro-6H-quinolin-1-yl)-N-ethylacetamide?
The InChIKey is KDFNWHYDNVTULN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O3/c1-2-14-12(17)8-15-10-4-3-5-11(16)9(10)6-7-13(15)18/h6-7H,2-5,8H2,1H3,(H,14,17).
What are the key properties of 2-(2,5-dioxo-7,8-dihydro-6H-quinolin-1-yl)-N-ethylacetamide?
2-(2,5-dioxo-7,8-dihydro-6H-quinolin-1-yl)-N-ethylacetamide has a molecular weight of 248.28 g/mol, XLogP of 0.50, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dioxo-7,8-dihydro-6H-quinolin-1-yl)-N-ethylacetamide is sourced from PubChem (CID 81109283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).