About 6-tert-butyl-3,3-diethyl-1-(3-fluoropropyl)piperazine-2,5-dione
6-tert-butyl-3,3-diethyl-1-(3-fluoropropyl)piperazine-2,5-dione (PubChem CID 81109591) has the molecular formula C15H27FN2O2
and a molecular weight of 286.39 g/mol. Its IUPAC name is 6-tert-butyl-3,3-diethyl-1-(3-fluoropropyl)piperazine-2,5-dione.
Molecular Properties
| Compound Name | 6-tert-butyl-3,3-diethyl-1-(3-fluoropropyl)piperazine-2,5-dione |
| PubChem CID | 81109591 |
| Molecular Formula | C15H27FN2O2 |
| Molecular Weight | 286.39 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | 6-tert-butyl-3,3-diethyl-1-(3-fluoropropyl)piperazine-2,5-dione |
| SMILES | CCC1(CC)NC(=O)C(C(C)(C)C)N(CCCF)C1=O |
| InChI | InChI=1S/C15H27FN2O2/c1-6-15(7-2)13(20)18(10-8-9-16)11(12(19)17-15)14(3,4)5/h11H,6-10H2,1-5H3,(H,17,19) |
| InChIKey | RKGYAAYZAIUUJK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.39 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-tert-butyl-3,3-diethyl-1-(3-fluoropropyl)piperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-3,3-diethyl-1-(3-fluoropropyl)piperazine-2,5-dione?
The IUPAC name of 6-tert-butyl-3,3-diethyl-1-(3-fluoropropyl)piperazine-2,5-dione (CID 81109591) is 6-tert-butyl-3,3-diethyl-1-(3-fluoropropyl)piperazine-2,5-dione.
What is the SMILES notation for 6-tert-butyl-3,3-diethyl-1-(3-fluoropropyl)piperazine-2,5-dione?
The canonical SMILES for 6-tert-butyl-3,3-diethyl-1-(3-fluoropropyl)piperazine-2,5-dione is CCC1(CC)NC(=O)C(C(C)(C)C)N(CCCF)C1=O.
What is the InChIKey of 6-tert-butyl-3,3-diethyl-1-(3-fluoropropyl)piperazine-2,5-dione?
The InChIKey is RKGYAAYZAIUUJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27FN2O2/c1-6-15(7-2)13(20)18(10-8-9-16)11(12(19)17-15)14(3,4)5/h11H,6-10H2,1-5H3,(H,17,19).
What are the key properties of 6-tert-butyl-3,3-diethyl-1-(3-fluoropropyl)piperazine-2,5-dione?
6-tert-butyl-3,3-diethyl-1-(3-fluoropropyl)piperazine-2,5-dione has a molecular weight of 286.39 g/mol, XLogP of 2.28, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-3,3-diethyl-1-(3-fluoropropyl)piperazine-2,5-dione is sourced from PubChem (CID 81109591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).