C16H22BrNO — CID 81109910
2-bromo-5-methyl-N-(2-methylcycloheptyl)benzamide (PubChem CID 81109910) has the molecular formula C16H22BrNO and a molecular weight of 324.26 g/mol. Its IUPAC name is 2-bromo-5-methyl-N-(2-methylcycloheptyl)benzamide.
| Compound Name | 2-bromo-5-methyl-N-(2-methylcycloheptyl)benzamide |
|---|---|
| PubChem CID | 81109910 |
| Molecular Formula | C16H22BrNO |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 2-bromo-5-methyl-N-(2-methylcycloheptyl)benzamide |
| SMILES | Cc1ccc(Br)c(C(=O)NC2CCCCCC2C)c1 |
| InChI | InChI=1S/C16H22BrNO/c1-11-8-9-14(17)13(10-11)16(19)18-15-7-5-3-4-6-12(15)2/h8-10,12,15H,3-7H2,1-2H3,(H,18,19) |
| InChIKey | CWVXBGSDNJBDKN-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |