C14H10BrCl2NO — CID 81110211
2-bromo-N-(3,5-dichlorophenyl)-5-methylbenzamide (PubChem CID 81110211) has the molecular formula C14H10BrCl2NO and a molecular weight of 359.05 g/mol. Its IUPAC name is 2-bromo-N-(3,5-dichlorophenyl)-5-methylbenzamide.
| Compound Name | 2-bromo-N-(3,5-dichlorophenyl)-5-methylbenzamide |
|---|---|
| PubChem CID | 81110211 |
| Molecular Formula | C14H10BrCl2NO |
| Molecular Weight | 359.05 g/mol |
| Exact Mass | 356.93 |
| IUPAC Name | 2-bromo-N-(3,5-dichlorophenyl)-5-methylbenzamide |
| SMILES | Cc1ccc(Br)c(C(=O)Nc2cc(Cl)cc(Cl)c2)c1 |
| InChI | InChI=1S/C14H10BrCl2NO/c1-8-2-3-13(15)12(4-8)14(19)18-11-6-9(16)5-10(17)7-11/h2-7H,1H3,(H,18,19) |
| InChIKey | QKFRUDAUTYFTTJ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.05 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |