C18H22BrN — CID 81110402
(2-bromo-5-methylphenyl)-(2,5-diethylphenyl)methanamine (PubChem CID 81110402) has the molecular formula C18H22BrN and a molecular weight of 332.29 g/mol. Its IUPAC name is (2-bromo-5-methylphenyl)-(2,5-diethylphenyl)methanamine.
| Compound Name | (2-bromo-5-methylphenyl)-(2,5-diethylphenyl)methanamine |
|---|---|
| PubChem CID | 81110402 |
| Molecular Formula | C18H22BrN |
| Molecular Weight | 332.29 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | (2-bromo-5-methylphenyl)-(2,5-diethylphenyl)methanamine |
| SMILES | CCc1ccc(CC)c(C(N)c2cc(C)ccc2Br)c1 |
| InChI | InChI=1S/C18H22BrN/c1-4-13-7-8-14(5-2)15(11-13)18(20)16-10-12(3)6-9-17(16)19/h6-11,18H,4-5,20H2,1-3H3 |
| InChIKey | ZYCRVJKSJHKTMB-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.29 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |