C15H17BrN2OS — CID 81110700
1-(2-bromo-5-methylbenzoyl)-4-methylsulfanylpiperidine-4-carbonitrile (PubChem CID 81110700) has the molecular formula C15H17BrN2OS and a molecular weight of 353.29 g/mol. Its IUPAC name is 1-(2-bromo-5-methylbenzoyl)-4-methylsulfanylpiperidine-4-carbonitrile.
| Compound Name | 1-(2-bromo-5-methylbenzoyl)-4-methylsulfanylpiperidine-4-carbonitrile |
|---|---|
| PubChem CID | 81110700 |
| Molecular Formula | C15H17BrN2OS |
| Molecular Weight | 353.29 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | 1-(2-bromo-5-methylbenzoyl)-4-methylsulfanylpiperidine-4-carbonitrile |
| SMILES | CSC1(C#N)CCN(C(=O)c2cc(C)ccc2Br)CC1 |
| InChI | InChI=1S/C15H17BrN2OS/c1-11-3-4-13(16)12(9-11)14(19)18-7-5-15(10-17,20-2)6-8-18/h3-4,9H,5-8H2,1-2H3 |
| InChIKey | DGCJYNPWGSKYLX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.29 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |