About 6-(3-fluoropropoxy)-2,3-dihydro-1-benzofuran-3-ol
6-(3-fluoropropoxy)-2,3-dihydro-1-benzofuran-3-ol (PubChem CID 81113494) has the molecular formula C11H13FO3
and a molecular weight of 212.22 g/mol. Its IUPAC name is 6-(3-fluoropropoxy)-2,3-dihydro-1-benzofuran-3-ol.
Molecular Properties
| Compound Name | 6-(3-fluoropropoxy)-2,3-dihydro-1-benzofuran-3-ol |
| PubChem CID | 81113494 |
| Molecular Formula | C11H13FO3 |
| Molecular Weight | 212.22 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 6-(3-fluoropropoxy)-2,3-dihydro-1-benzofuran-3-ol |
| SMILES | OC1COc2cc(OCCCF)ccc21 |
| InChI | InChI=1S/C11H13FO3/c12-4-1-5-14-8-2-3-9-10(13)7-15-11(9)6-8/h2-3,6,10,13H,1,4-5,7H2 |
| InChIKey | JLZAVQFWIUZJSK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.22 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(3-fluoropropoxy)-2,3-dihydro-1-benzofuran-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-fluoropropoxy)-2,3-dihydro-1-benzofuran-3-ol?
The IUPAC name of 6-(3-fluoropropoxy)-2,3-dihydro-1-benzofuran-3-ol (CID 81113494) is 6-(3-fluoropropoxy)-2,3-dihydro-1-benzofuran-3-ol.
What is the SMILES notation for 6-(3-fluoropropoxy)-2,3-dihydro-1-benzofuran-3-ol?
The canonical SMILES for 6-(3-fluoropropoxy)-2,3-dihydro-1-benzofuran-3-ol is OC1COc2cc(OCCCF)ccc21.
What is the InChIKey of 6-(3-fluoropropoxy)-2,3-dihydro-1-benzofuran-3-ol?
The InChIKey is JLZAVQFWIUZJSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13FO3/c12-4-1-5-14-8-2-3-9-10(13)7-15-11(9)6-8/h2-3,6,10,13H,1,4-5,7H2.
What are the key properties of 6-(3-fluoropropoxy)-2,3-dihydro-1-benzofuran-3-ol?
6-(3-fluoropropoxy)-2,3-dihydro-1-benzofuran-3-ol has a molecular weight of 212.22 g/mol, XLogP of 1.85, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-fluoropropoxy)-2,3-dihydro-1-benzofuran-3-ol is sourced from PubChem (CID 81113494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).