1-(3-fluoropropyl)pyrazole-4-sulfonyl chloride

C6H8ClFN2O2S — CID 81113658

IUPAC1-(3-fluoropropyl)pyrazole-4-sulfonyl chloride
SMILESO=S(=O)(Cl)c1cnn(CCCF)c1
InChIInChI=1S/C6H8ClFN2O2S/c7-13(11,12)6-4-9-10(5-6)3-1-2-8/h4-5H,1-3H2
InChIKeyJZZXNHOCFYUKPL-UHFFFAOYSA-N
MW226.66 g/mol
LogP1.17
Rot. Bonds4

About 1-(3-fluoropropyl)pyrazole-4-sulfonyl chloride

1-(3-fluoropropyl)pyrazole-4-sulfonyl chloride (PubChem CID 81113658) has the molecular formula C6H8ClFN2O2S and a molecular weight of 226.66 g/mol. Its IUPAC name is 1-(3-fluoropropyl)pyrazole-4-sulfonyl chloride.

Molecular Properties

Compound Name1-(3-fluoropropyl)pyrazole-4-sulfonyl chloride
PubChem CID81113658
Molecular FormulaC6H8ClFN2O2S
Molecular Weight226.66 g/mol
Exact Mass226.00
IUPAC Name1-(3-fluoropropyl)pyrazole-4-sulfonyl chloride
SMILESO=S(=O)(Cl)c1cnn(CCCF)c1
InChIInChI=1S/C6H8ClFN2O2S/c7-13(11,12)6-4-9-10(5-6)3-1-2-8/h4-5H,1-3H2
InChIKeyJZZXNHOCFYUKPL-UHFFFAOYSA-N
XLogP1.17
TPSA51.96 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.66
LogP ≤ 51.17
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 1-(3-fluoropropyl)pyrazole-4-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(3-fluoropropyl)pyrazole-4-sulfonyl chloride?
The IUPAC name of 1-(3-fluoropropyl)pyrazole-4-sulfonyl chloride (CID 81113658) is 1-(3-fluoropropyl)pyrazole-4-sulfonyl chloride.
What is the SMILES notation for 1-(3-fluoropropyl)pyrazole-4-sulfonyl chloride?
The canonical SMILES for 1-(3-fluoropropyl)pyrazole-4-sulfonyl chloride is O=S(=O)(Cl)c1cnn(CCCF)c1.
What is the InChIKey of 1-(3-fluoropropyl)pyrazole-4-sulfonyl chloride?
The InChIKey is JZZXNHOCFYUKPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8ClFN2O2S/c7-13(11,12)6-4-9-10(5-6)3-1-2-8/h4-5H,1-3H2.
What are the key properties of 1-(3-fluoropropyl)pyrazole-4-sulfonyl chloride?
1-(3-fluoropropyl)pyrazole-4-sulfonyl chloride has a molecular weight of 226.66 g/mol, XLogP of 1.17, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-fluoropropyl)pyrazole-4-sulfonyl chloride is sourced from PubChem (CID 81113658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).