About 1-(3-fluoropropyl)-2,5-dipropylpiperazine
1-(3-fluoropropyl)-2,5-dipropylpiperazine (PubChem CID 81114186) has the molecular formula C13H27FN2
and a molecular weight of 230.37 g/mol. Its IUPAC name is 1-(3-fluoropropyl)-2,5-dipropylpiperazine.
Molecular Properties
| Compound Name | 1-(3-fluoropropyl)-2,5-dipropylpiperazine |
| PubChem CID | 81114186 |
| Molecular Formula | C13H27FN2 |
| Molecular Weight | 230.37 g/mol |
| Exact Mass | 230.22 |
| IUPAC Name | 1-(3-fluoropropyl)-2,5-dipropylpiperazine |
| SMILES | CCCC1CN(CCCF)C(CCC)CN1 |
| InChI | InChI=1S/C13H27FN2/c1-3-6-12-11-16(9-5-8-14)13(7-4-2)10-15-12/h12-13,15H,3-11H2,1-2H3 |
| InChIKey | UYFKIVRBIXJATO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(3-fluoropropyl)-2,5-dipropylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-fluoropropyl)-2,5-dipropylpiperazine?
The IUPAC name of 1-(3-fluoropropyl)-2,5-dipropylpiperazine (CID 81114186) is 1-(3-fluoropropyl)-2,5-dipropylpiperazine.
What is the SMILES notation for 1-(3-fluoropropyl)-2,5-dipropylpiperazine?
The canonical SMILES for 1-(3-fluoropropyl)-2,5-dipropylpiperazine is CCCC1CN(CCCF)C(CCC)CN1.
What is the InChIKey of 1-(3-fluoropropyl)-2,5-dipropylpiperazine?
The InChIKey is UYFKIVRBIXJATO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27FN2/c1-3-6-12-11-16(9-5-8-14)13(7-4-2)10-15-12/h12-13,15H,3-11H2,1-2H3.
What are the key properties of 1-(3-fluoropropyl)-2,5-dipropylpiperazine?
1-(3-fluoropropyl)-2,5-dipropylpiperazine has a molecular weight of 230.37 g/mol, XLogP of 2.59, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-fluoropropyl)-2,5-dipropylpiperazine is sourced from PubChem (CID 81114186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).