C13H27FN2 — CID 81114186
1-(3-fluoropropyl)-2,5-dipropylpiperazine (PubChem CID 81114186) has the molecular formula C13H27FN2 and a molecular weight of 230.37 g/mol. Its IUPAC name is 1-(3-fluoropropyl)-2,5-dipropylpiperazine.
| Compound Name | 1-(3-fluoropropyl)-2,5-dipropylpiperazine |
|---|---|
| PubChem CID | 81114186 |
| Molecular Formula | C13H27FN2 |
| Molecular Weight | 230.37 g/mol |
| Exact Mass | 230.22 |
| IUPAC Name | 1-(3-fluoropropyl)-2,5-dipropylpiperazine |
| SMILES | CCCC1CN(CCCF)C(CCC)CN1 |
| InChI | InChI=1S/C13H27FN2/c1-3-6-12-11-16(9-5-8-14)13(7-4-2)10-15-12/h12-13,15H,3-11H2,1-2H3 |
| InChIKey | UYFKIVRBIXJATO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |