4-(3-fluoropropylamino)cyclohexane-1-carboxylic acid

C10H18FNO2 — CID 81114237

IUPAC4-(3-fluoropropylamino)cyclohexane-1-carboxylic acid
SMILESO=C(O)C1CCC(NCCCF)CC1
InChIInChI=1S/C10H18FNO2/c11-6-1-7-12-9-4-2-8(3-5-9)10(13)14/h8-9,12H,1-7H2,(H,13,14)
InChIKeyPYCNWZOSGBUQQJ-UHFFFAOYSA-N
MW203.26 g/mol
LogP1.58
Rot. Bonds5

About 4-(3-fluoropropylamino)cyclohexane-1-carboxylic acid

4-(3-fluoropropylamino)cyclohexane-1-carboxylic acid (PubChem CID 81114237) has the molecular formula C10H18FNO2 and a molecular weight of 203.26 g/mol. Its IUPAC name is 4-(3-fluoropropylamino)cyclohexane-1-carboxylic acid.

Molecular Properties

Compound Name4-(3-fluoropropylamino)cyclohexane-1-carboxylic acid
PubChem CID81114237
Molecular FormulaC10H18FNO2
Molecular Weight203.26 g/mol
Exact Mass203.13
IUPAC Name4-(3-fluoropropylamino)cyclohexane-1-carboxylic acid
SMILESO=C(O)C1CCC(NCCCF)CC1
InChIInChI=1S/C10H18FNO2/c11-6-1-7-12-9-4-2-8(3-5-9)10(13)14/h8-9,12H,1-7H2,(H,13,14)
InChIKeyPYCNWZOSGBUQQJ-UHFFFAOYSA-N
XLogP1.58
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500203.26
LogP ≤ 51.58
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-(3-fluoropropylamino)cyclohexane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

4-Aminocyclohexanecarboxylic acid
CID 171560
4-Acetamidocyclohexane-1-carboxylic acid
CID 14788214
4-(Carbamoylamino)cyclohexane-1-carboxylic acid
CID 45792187
Ethyl 4-(ethylamino)cyclohexane-1-carboxylate
CID 57617608
4-(Hexadecylamino)cyclohexane-1-carboxylic acid
CID 44279625
4-Cyclopentaneamidocyclohexane-1-carboxylic acid
CID 21572331
4-(2-Cyclopentylacetamido)cyclohexane-1-carboxylic acid
CID 47003024
4-(2-Cyclohexylacetamido)cyclohexane-1-carboxylic acid
CID 47003034
Cis-4-(methylamino)cyclohexanecarboxylic acid
CID 429561
4-(2-Fluoroethylcarbamoylamino)cyclohexane-1-carboxylic acid
CID 312741
trans-4-(Dimethylamino)cyclohexanecarboxylic acid
CID 14876726
(1R,3S,4R)-4-amino-3-fluorocyclohexane-1-carboxylic acid
CID 68700713

Frequently Asked Questions

What is the IUPAC name of 4-(3-fluoropropylamino)cyclohexane-1-carboxylic acid?
The IUPAC name of 4-(3-fluoropropylamino)cyclohexane-1-carboxylic acid (CID 81114237) is 4-(3-fluoropropylamino)cyclohexane-1-carboxylic acid.
What is the SMILES notation for 4-(3-fluoropropylamino)cyclohexane-1-carboxylic acid?
The canonical SMILES for 4-(3-fluoropropylamino)cyclohexane-1-carboxylic acid is O=C(O)C1CCC(NCCCF)CC1.
What is the InChIKey of 4-(3-fluoropropylamino)cyclohexane-1-carboxylic acid?
The InChIKey is PYCNWZOSGBUQQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18FNO2/c11-6-1-7-12-9-4-2-8(3-5-9)10(13)14/h8-9,12H,1-7H2,(H,13,14).
What are the key properties of 4-(3-fluoropropylamino)cyclohexane-1-carboxylic acid?
4-(3-fluoropropylamino)cyclohexane-1-carboxylic acid has a molecular weight of 203.26 g/mol, XLogP of 1.58, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-fluoropropylamino)cyclohexane-1-carboxylic acid is sourced from PubChem (CID 81114237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).