About 8-cyclopropyl-6-(3-fluoropropyl)-6,9-diazaspiro[4.5]decane
8-cyclopropyl-6-(3-fluoropropyl)-6,9-diazaspiro[4.5]decane (PubChem CID 81114558) has the molecular formula C14H25FN2
and a molecular weight of 240.37 g/mol. Its IUPAC name is 8-cyclopropyl-6-(3-fluoropropyl)-6,9-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 8-cyclopropyl-6-(3-fluoropropyl)-6,9-diazaspiro[4.5]decane |
| PubChem CID | 81114558 |
| Molecular Formula | C14H25FN2 |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.20 |
| IUPAC Name | 8-cyclopropyl-6-(3-fluoropropyl)-6,9-diazaspiro[4.5]decane |
| SMILES | FCCCN1CC(C2CC2)NCC12CCCC2 |
| InChI | InChI=1S/C14H25FN2/c15-8-3-9-17-10-13(12-4-5-12)16-11-14(17)6-1-2-7-14/h12-13,16H,1-11H2 |
| InChIKey | HBNMDUZMWDNYRK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-cyclopropyl-6-(3-fluoropropyl)-6,9-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-cyclopropyl-6-(3-fluoropropyl)-6,9-diazaspiro[4.5]decane?
The IUPAC name of 8-cyclopropyl-6-(3-fluoropropyl)-6,9-diazaspiro[4.5]decane (CID 81114558) is 8-cyclopropyl-6-(3-fluoropropyl)-6,9-diazaspiro[4.5]decane.
What is the SMILES notation for 8-cyclopropyl-6-(3-fluoropropyl)-6,9-diazaspiro[4.5]decane?
The canonical SMILES for 8-cyclopropyl-6-(3-fluoropropyl)-6,9-diazaspiro[4.5]decane is FCCCN1CC(C2CC2)NCC12CCCC2.
What is the InChIKey of 8-cyclopropyl-6-(3-fluoropropyl)-6,9-diazaspiro[4.5]decane?
The InChIKey is HBNMDUZMWDNYRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25FN2/c15-8-3-9-17-10-13(12-4-5-12)16-11-14(17)6-1-2-7-14/h12-13,16H,1-11H2.
What are the key properties of 8-cyclopropyl-6-(3-fluoropropyl)-6,9-diazaspiro[4.5]decane?
8-cyclopropyl-6-(3-fluoropropyl)-6,9-diazaspiro[4.5]decane has a molecular weight of 240.37 g/mol, XLogP of 2.34, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-cyclopropyl-6-(3-fluoropropyl)-6,9-diazaspiro[4.5]decane is sourced from PubChem (CID 81114558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).