About 3-fluoropropyl 4-amino-5-methylthiophene-2-carboxylate
3-fluoropropyl 4-amino-5-methylthiophene-2-carboxylate (PubChem CID 81114861) has the molecular formula C9H12FNO2S
and a molecular weight of 217.26 g/mol. Its IUPAC name is 3-fluoropropyl 4-amino-5-methylthiophene-2-carboxylate.
Molecular Properties
| Compound Name | 3-fluoropropyl 4-amino-5-methylthiophene-2-carboxylate |
| PubChem CID | 81114861 |
| Molecular Formula | C9H12FNO2S |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 3-fluoropropyl 4-amino-5-methylthiophene-2-carboxylate |
| SMILES | Cc1sc(C(=O)OCCCF)cc1N |
| InChI | InChI=1S/C9H12FNO2S/c1-6-7(11)5-8(14-6)9(12)13-4-2-3-10/h5H,2-4,11H2,1H3 |
| InChIKey | MTVSKPLVIRXXRR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoropropyl 4-amino-5-methylthiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoropropyl 4-amino-5-methylthiophene-2-carboxylate?
The IUPAC name of 3-fluoropropyl 4-amino-5-methylthiophene-2-carboxylate (CID 81114861) is 3-fluoropropyl 4-amino-5-methylthiophene-2-carboxylate.
What is the SMILES notation for 3-fluoropropyl 4-amino-5-methylthiophene-2-carboxylate?
The canonical SMILES for 3-fluoropropyl 4-amino-5-methylthiophene-2-carboxylate is Cc1sc(C(=O)OCCCF)cc1N.
What is the InChIKey of 3-fluoropropyl 4-amino-5-methylthiophene-2-carboxylate?
The InChIKey is MTVSKPLVIRXXRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12FNO2S/c1-6-7(11)5-8(14-6)9(12)13-4-2-3-10/h5H,2-4,11H2,1H3.
What are the key properties of 3-fluoropropyl 4-amino-5-methylthiophene-2-carboxylate?
3-fluoropropyl 4-amino-5-methylthiophene-2-carboxylate has a molecular weight of 217.26 g/mol, XLogP of 2.16, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoropropyl 4-amino-5-methylthiophene-2-carboxylate is sourced from PubChem (CID 81114861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).