C16H31NOS — CID 81115193
2-[2-ethyl-2-(sulfanylmethyl)butyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol (PubChem CID 81115193) has the molecular formula C16H31NOS and a molecular weight of 285.50 g/mol. Its IUPAC name is 2-[2-ethyl-2-(sulfanylmethyl)butyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol.
| Compound Name | 2-[2-ethyl-2-(sulfanylmethyl)butyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
|---|---|
| PubChem CID | 81115193 |
| Molecular Formula | C16H31NOS |
| Molecular Weight | 285.50 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | 2-[2-ethyl-2-(sulfanylmethyl)butyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
| SMILES | CCC(CC)(CS)CN1CCC2(O)CCCCC2C1 |
| InChI | InChI=1S/C16H31NOS/c1-3-15(4-2,13-19)12-17-10-9-16(18)8-6-5-7-14(16)11-17/h14,18-19H,3-13H2,1-2H3 |
| InChIKey | IMRRYPCBUSUPOH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|