C15H17F3N2O — CID 81116722
4-[[methyl-[(2-methylfuran-3-yl)methyl]amino]methyl]-3-(trifluoromethyl)aniline (PubChem CID 81116722) has the molecular formula C15H17F3N2O and a molecular weight of 298.31 g/mol. Its IUPAC name is 4-[[methyl-[(2-methylfuran-3-yl)methyl]amino]methyl]-3-(trifluoromethyl)aniline.
| Compound Name | 4-[[methyl-[(2-methylfuran-3-yl)methyl]amino]methyl]-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 81116722 |
| Molecular Formula | C15H17F3N2O |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 4-[[methyl-[(2-methylfuran-3-yl)methyl]amino]methyl]-3-(trifluoromethyl)aniline |
| SMILES | Cc1occc1CN(C)Cc1ccc(N)cc1C(F)(F)F |
| InChI | InChI=1S/C15H17F3N2O/c1-10-11(5-6-21-10)8-20(2)9-12-3-4-13(19)7-14(12)15(16,17)18/h3-7H,8-9,19H2,1-2H3 |
| InChIKey | RFCNYKWCOGJYFT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|