C9H8FN3OS — CID 811168
5-[(2-fluorophenoxy)methyl]-1,3,4-thiadiazol-2-amine (PubChem CID 811168) has the molecular formula C9H8FN3OS and a molecular weight of 225.25 g/mol. Its IUPAC name is 5-[(2-fluorophenoxy)methyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[(2-fluorophenoxy)methyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 811168 |
| Molecular Formula | C9H8FN3OS |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | 5-[(2-fluorophenoxy)methyl]-1,3,4-thiadiazol-2-amine |
| SMILES | Nc1nnc(COc2ccccc2F)s1 |
| InChI | InChI=1S/C9H8FN3OS/c10-6-3-1-2-4-7(6)14-5-8-12-13-9(11)15-8/h1-4H,5H2,(H2,11,13) |
| InChIKey | ODVFNADVLNIXOS-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |