C14H10Cl2F3NO — CID 81117337
4-[(2,6-dichlorophenoxy)methyl]-3-(trifluoromethyl)aniline (PubChem CID 81117337) has the molecular formula C14H10Cl2F3NO and a molecular weight of 336.14 g/mol. Its IUPAC name is 4-[(2,6-dichlorophenoxy)methyl]-3-(trifluoromethyl)aniline.
| Compound Name | 4-[(2,6-dichlorophenoxy)methyl]-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 81117337 |
| Molecular Formula | C14H10Cl2F3NO |
| Molecular Weight | 336.14 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | 4-[(2,6-dichlorophenoxy)methyl]-3-(trifluoromethyl)aniline |
| SMILES | Nc1ccc(COc2c(Cl)cccc2Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H10Cl2F3NO/c15-11-2-1-3-12(16)13(11)21-7-8-4-5-9(20)6-10(8)14(17,18)19/h1-6H,7,20H2 |
| InChIKey | KRJFXMXXBPKXHC-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.14 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|