C16H21F3N2 — CID 81117529
4-[[bis(cyclopropylmethyl)amino]methyl]-3-(trifluoromethyl)aniline (PubChem CID 81117529) has the molecular formula C16H21F3N2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 4-[[bis(cyclopropylmethyl)amino]methyl]-3-(trifluoromethyl)aniline.
| Compound Name | 4-[[bis(cyclopropylmethyl)amino]methyl]-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 81117529 |
| Molecular Formula | C16H21F3N2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 4-[[bis(cyclopropylmethyl)amino]methyl]-3-(trifluoromethyl)aniline |
| SMILES | Nc1ccc(CN(CC2CC2)CC2CC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H21F3N2/c17-16(18,19)15-7-14(20)6-5-13(15)10-21(8-11-1-2-11)9-12-3-4-12/h5-7,11-12H,1-4,8-10,20H2 |
| InChIKey | ZAKLKJSQXFMXRU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|