C17H19BrO — CID 81117922
1-(2-bromo-5-methylphenyl)-2-(3,4-dimethylphenyl)ethanol (PubChem CID 81117922) has the molecular formula C17H19BrO and a molecular weight of 319.24 g/mol. Its IUPAC name is 1-(2-bromo-5-methylphenyl)-2-(3,4-dimethylphenyl)ethanol.
| Compound Name | 1-(2-bromo-5-methylphenyl)-2-(3,4-dimethylphenyl)ethanol |
|---|---|
| PubChem CID | 81117922 |
| Molecular Formula | C17H19BrO |
| Molecular Weight | 319.24 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 1-(2-bromo-5-methylphenyl)-2-(3,4-dimethylphenyl)ethanol |
| SMILES | Cc1ccc(Br)c(C(O)Cc2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C17H19BrO/c1-11-4-7-16(18)15(8-11)17(19)10-14-6-5-12(2)13(3)9-14/h4-9,17,19H,10H2,1-3H3 |
| InChIKey | NGYSBLKLJUOQBD-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.24 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |