C15H19FN2O3 — CID 81119032
(3S)-1-[ethyl-(2-fluorophenyl)carbamoyl]piperidine-3-carboxylic acid (PubChem CID 81119032) has the molecular formula C15H19FN2O3 and a molecular weight of 294.33 g/mol. Its IUPAC name is (3S)-1-[ethyl-(2-fluorophenyl)carbamoyl]piperidine-3-carboxylic acid.
| Compound Name | (3S)-1-[ethyl-(2-fluorophenyl)carbamoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 81119032 |
| Molecular Formula | C15H19FN2O3 |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | (3S)-1-[ethyl-(2-fluorophenyl)carbamoyl]piperidine-3-carboxylic acid |
| SMILES | CCN(C(=O)N1CCC[C@H](C(=O)O)C1)c1ccccc1F |
| InChI | InChI=1S/C15H19FN2O3/c1-2-18(13-8-4-3-7-12(13)16)15(21)17-9-5-6-11(10-17)14(19)20/h3-4,7-8,11H,2,5-6,9-10H2,1H3,(H,19,20)/t11-/m0/s1 |
| InChIKey | XTSZYRQWCBSTNH-NSHDSACASA-N |
| XLogP | 2.57 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |