C10H17NO6S — CID 81120444
(3R)-1-(1-methoxy-1-oxopropan-2-yl)sulfonylpiperidine-3-carboxylic acid (PubChem CID 81120444) has the molecular formula C10H17NO6S and a molecular weight of 279.31 g/mol. Its IUPAC name is (3R)-1-(1-methoxy-1-oxopropan-2-yl)sulfonylpiperidine-3-carboxylic acid.
| Compound Name | (3R)-1-(1-methoxy-1-oxopropan-2-yl)sulfonylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 81120444 |
| Molecular Formula | C10H17NO6S |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | (3R)-1-(1-methoxy-1-oxopropan-2-yl)sulfonylpiperidine-3-carboxylic acid |
| SMILES | COC(=O)C(C)S(=O)(=O)N1CCC[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C10H17NO6S/c1-7(10(14)17-2)18(15,16)11-5-3-4-8(6-11)9(12)13/h7-8H,3-6H2,1-2H3,(H,12,13)/t7?,8-/m1/s1 |
| InChIKey | WVWKWWYHASACGS-BRFYHDHCSA-N |
| XLogP | -0.33 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |