C14H14N2O3S2 — CID 81121383
N-[4-(2-amino-2-sulfanylideneethoxy)phenyl]-4-methoxythiophene-2-carboxamide (PubChem CID 81121383) has the molecular formula C14H14N2O3S2 and a molecular weight of 322.41 g/mol. Its IUPAC name is N-[4-(2-amino-2-sulfanylideneethoxy)phenyl]-4-methoxythiophene-2-carboxamide.
| Compound Name | N-[4-(2-amino-2-sulfanylideneethoxy)phenyl]-4-methoxythiophene-2-carboxamide |
|---|---|
| PubChem CID | 81121383 |
| Molecular Formula | C14H14N2O3S2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | N-[4-(2-amino-2-sulfanylideneethoxy)phenyl]-4-methoxythiophene-2-carboxamide |
| SMILES | COc1csc(C(=O)Nc2ccc(OCC(N)=S)cc2)c1 |
| InChI | InChI=1S/C14H14N2O3S2/c1-18-11-6-12(21-8-11)14(17)16-9-2-4-10(5-3-9)19-7-13(15)20/h2-6,8H,7H2,1H3,(H2,15,20)(H,16,17) |
| InChIKey | OZIYMPOZIKXIIV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|