C13H14FNOS — CID 81122039
2-(2-fluorophenyl)-1-(4-methoxythiophen-2-yl)ethanamine (PubChem CID 81122039) has the molecular formula C13H14FNOS and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-1-(4-methoxythiophen-2-yl)ethanamine.
| Compound Name | 2-(2-fluorophenyl)-1-(4-methoxythiophen-2-yl)ethanamine |
|---|---|
| PubChem CID | 81122039 |
| Molecular Formula | C13H14FNOS |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 2-(2-fluorophenyl)-1-(4-methoxythiophen-2-yl)ethanamine |
| SMILES | COc1csc(C(N)Cc2ccccc2F)c1 |
| InChI | InChI=1S/C13H14FNOS/c1-16-10-7-13(17-8-10)12(15)6-9-4-2-3-5-11(9)14/h2-5,7-8,12H,6,15H2,1H3 |
| InChIKey | JYHUTFYHLQFNCA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |