C12H22N2O — CID 81123466
(2-methylpiperidin-1-yl)-[(3R)-piperidin-3-yl]methanone (PubChem CID 81123466) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is (2-methylpiperidin-1-yl)-[(3R)-piperidin-3-yl]methanone.
| Compound Name | (2-methylpiperidin-1-yl)-[(3R)-piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 81123466 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | (2-methylpiperidin-1-yl)-[(3R)-piperidin-3-yl]methanone |
| SMILES | CC1CCCCN1C(=O)[C@@H]1CCCNC1 |
| InChI | InChI=1S/C12H22N2O/c1-10-5-2-3-8-14(10)12(15)11-6-4-7-13-9-11/h10-11,13H,2-9H2,1H3/t10?,11-/m1/s1 |
| InChIKey | VMMVKFDXSFIKOX-RRKGBCIJSA-N |
| XLogP | 1.39 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |