C15H26N2O3 — CID 81126261
(3S)-1-[(3,5-dimethylcyclohexyl)carbamoyl]piperidine-3-carboxylic acid (PubChem CID 81126261) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is (3S)-1-[(3,5-dimethylcyclohexyl)carbamoyl]piperidine-3-carboxylic acid.
| Compound Name | (3S)-1-[(3,5-dimethylcyclohexyl)carbamoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 81126261 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | (3S)-1-[(3,5-dimethylcyclohexyl)carbamoyl]piperidine-3-carboxylic acid |
| SMILES | CC1CC(C)CC(NC(=O)N2CCC[C@H](C(=O)O)C2)C1 |
| InChI | InChI=1S/C15H26N2O3/c1-10-6-11(2)8-13(7-10)16-15(20)17-5-3-4-12(9-17)14(18)19/h10-13H,3-9H2,1-2H3,(H,16,20)(H,18,19)/t10?,11?,12-,13?/m0/s1 |
| InChIKey | MAZZHEWMLZZRDN-ARAJFMJPSA-N |
| XLogP | 2.32 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |