About (3S)-1-(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)piperidine-3-carboxylic acid
(3S)-1-(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)piperidine-3-carboxylic acid (PubChem CID 81126270) has the molecular formula C14H18N2O4
and a molecular weight of 278.31 g/mol. Its IUPAC name is (3S)-1-(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)piperidine-3-carboxylic acid.
Molecular Properties
| Compound Name | (3S)-1-(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)piperidine-3-carboxylic acid |
| PubChem CID | 81126270 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | (3S)-1-(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)piperidine-3-carboxylic acid |
| SMILES | Cc1cc(C)c(C(=O)N2CCC[C@H](C(=O)O)C2)c(=O)[nH]1 |
| InChI | InChI=1S/C14H18N2O4/c1-8-6-9(2)15-12(17)11(8)13(18)16-5-3-4-10(7-16)14(19)20/h6,10H,3-5,7H2,1-2H3,(H,15,17)(H,19,20)/t10-/m0/s1 |
| InChIKey | PUUNKLDLXOTVHB-JTQLQIEISA-N |
| XLogP | 0.93 |
| TPSA | 90.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-1-(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)piperidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1-(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)piperidine-3-carboxylic acid?
The IUPAC name of (3S)-1-(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)piperidine-3-carboxylic acid (CID 81126270) is (3S)-1-(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)piperidine-3-carboxylic acid.
What is the SMILES notation for (3S)-1-(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)piperidine-3-carboxylic acid?
The canonical SMILES for (3S)-1-(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)piperidine-3-carboxylic acid is Cc1cc(C)c(C(=O)N2CCC[C@H](C(=O)O)C2)c(=O)[nH]1.
What is the InChIKey of (3S)-1-(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)piperidine-3-carboxylic acid?
The InChIKey is PUUNKLDLXOTVHB-JTQLQIEISA-N. The full InChI is InChI=1S/C14H18N2O4/c1-8-6-9(2)15-12(17)11(8)13(18)16-5-3-4-10(7-16)14(19)20/h6,10H,3-5,7H2,1-2H3,(H,15,17)(H,19,20)/t10-/m0/s1.
What are the key properties of (3S)-1-(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)piperidine-3-carboxylic acid?
(3S)-1-(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)piperidine-3-carboxylic acid has a molecular weight of 278.31 g/mol, XLogP of 0.93, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1-(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)piperidine-3-carboxylic acid is sourced from PubChem (CID 81126270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).