C14H15Cl2NO4 — CID 81126899
(3R)-1-[2-(3,4-dichlorophenoxy)acetyl]piperidine-3-carboxylic acid (PubChem CID 81126899) has the molecular formula C14H15Cl2NO4 and a molecular weight of 332.18 g/mol. Its IUPAC name is (3R)-1-[2-(3,4-dichlorophenoxy)acetyl]piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-[2-(3,4-dichlorophenoxy)acetyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 81126899 |
| Molecular Formula | C14H15Cl2NO4 |
| Molecular Weight | 332.18 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | (3R)-1-[2-(3,4-dichlorophenoxy)acetyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN(C(=O)COc2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C14H15Cl2NO4/c15-11-4-3-10(6-12(11)16)21-8-13(18)17-5-1-2-9(7-17)14(19)20/h3-4,6,9H,1-2,5,7-8H2,(H,19,20)/t9-/m1/s1 |
| InChIKey | MKSJJNDPSBVJDH-SECBINFHSA-N |
| XLogP | 2.70 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.18 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |