C12H15NOS2 — CID 81128002
N-[(4-methoxythiophen-2-yl)-thiophen-2-ylmethyl]ethanamine (PubChem CID 81128002) has the molecular formula C12H15NOS2 and a molecular weight of 253.39 g/mol. Its IUPAC name is N-[(4-methoxythiophen-2-yl)-thiophen-2-ylmethyl]ethanamine.
| Compound Name | N-[(4-methoxythiophen-2-yl)-thiophen-2-ylmethyl]ethanamine |
|---|---|
| PubChem CID | 81128002 |
| Molecular Formula | C12H15NOS2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | N-[(4-methoxythiophen-2-yl)-thiophen-2-ylmethyl]ethanamine |
| SMILES | CCNC(c1cccs1)c1cc(OC)cs1 |
| InChI | InChI=1S/C12H15NOS2/c1-3-13-12(10-5-4-6-15-10)11-7-9(14-2)8-16-11/h4-8,12-13H,3H2,1-2H3 |
| InChIKey | KCHYXQVCGTZGRC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |