C11H19NO2S — CID 81128612
2-(aminomethyl)-1-(3-methoxythiophen-2-yl)pentan-1-ol (PubChem CID 81128612) has the molecular formula C11H19NO2S and a molecular weight of 229.34 g/mol. Its IUPAC name is 2-(aminomethyl)-1-(3-methoxythiophen-2-yl)pentan-1-ol.
| Compound Name | 2-(aminomethyl)-1-(3-methoxythiophen-2-yl)pentan-1-ol |
|---|---|
| PubChem CID | 81128612 |
| Molecular Formula | C11H19NO2S |
| Molecular Weight | 229.34 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 2-(aminomethyl)-1-(3-methoxythiophen-2-yl)pentan-1-ol |
| SMILES | CCCC(CN)C(O)c1sccc1OC |
| InChI | InChI=1S/C11H19NO2S/c1-3-4-8(7-12)10(13)11-9(14-2)5-6-15-11/h5-6,8,10,13H,3-4,7,12H2,1-2H3 |
| InChIKey | JVZUHEFZNOCCNB-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.34 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |