C15H17ClOS — CID 81129061
2-[1-chloro-2-(2,5-dimethylphenyl)ethyl]-4-methoxythiophene (PubChem CID 81129061) has the molecular formula C15H17ClOS and a molecular weight of 280.82 g/mol. Its IUPAC name is 2-[1-chloro-2-(2,5-dimethylphenyl)ethyl]-4-methoxythiophene.
| Compound Name | 2-[1-chloro-2-(2,5-dimethylphenyl)ethyl]-4-methoxythiophene |
|---|---|
| PubChem CID | 81129061 |
| Molecular Formula | C15H17ClOS |
| Molecular Weight | 280.82 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 2-[1-chloro-2-(2,5-dimethylphenyl)ethyl]-4-methoxythiophene |
| SMILES | COc1csc(C(Cl)Cc2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C15H17ClOS/c1-10-4-5-11(2)12(6-10)7-14(16)15-8-13(17-3)9-18-15/h4-6,8-9,14H,7H2,1-3H3 |
| InChIKey | DHAFYEZEDRNBLB-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.82 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|