About 7-bromo-3-[chloro-(2,4,6-trifluorophenyl)methyl]-1-benzothiophene
7-bromo-3-[chloro-(2,4,6-trifluorophenyl)methyl]-1-benzothiophene (PubChem CID 81129145) has the molecular formula C15H7BrClF3S
and a molecular weight of 391.64 g/mol. Its IUPAC name is 7-bromo-3-[chloro-(2,4,6-trifluorophenyl)methyl]-1-benzothiophene.
Molecular Properties
| Compound Name | 7-bromo-3-[chloro-(2,4,6-trifluorophenyl)methyl]-1-benzothiophene |
| PubChem CID | 81129145 |
| Molecular Formula | C15H7BrClF3S |
| Molecular Weight | 391.64 g/mol |
| Exact Mass | 389.91 |
| IUPAC Name | 7-bromo-3-[chloro-(2,4,6-trifluorophenyl)methyl]-1-benzothiophene |
| SMILES | Fc1cc(F)c(C(Cl)c2csc3c(Br)cccc23)c(F)c1 |
| InChI | InChI=1S/C15H7BrClF3S/c16-10-3-1-2-8-9(6-21-15(8)10)14(17)13-11(19)4-7(18)5-12(13)20/h1-6,14H |
| InChIKey | VLIYRDASJNPNBT-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.64 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 7-bromo-3-[chloro-(2,4,6-trifluorophenyl)methyl]-1-benzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-3-[chloro-(2,4,6-trifluorophenyl)methyl]-1-benzothiophene?
The IUPAC name of 7-bromo-3-[chloro-(2,4,6-trifluorophenyl)methyl]-1-benzothiophene (CID 81129145) is 7-bromo-3-[chloro-(2,4,6-trifluorophenyl)methyl]-1-benzothiophene.
What is the SMILES notation for 7-bromo-3-[chloro-(2,4,6-trifluorophenyl)methyl]-1-benzothiophene?
The canonical SMILES for 7-bromo-3-[chloro-(2,4,6-trifluorophenyl)methyl]-1-benzothiophene is Fc1cc(F)c(C(Cl)c2csc3c(Br)cccc23)c(F)c1.
What is the InChIKey of 7-bromo-3-[chloro-(2,4,6-trifluorophenyl)methyl]-1-benzothiophene?
The InChIKey is VLIYRDASJNPNBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H7BrClF3S/c16-10-3-1-2-8-9(6-21-15(8)10)14(17)13-11(19)4-7(18)5-12(13)20/h1-6,14H.
What are the key properties of 7-bromo-3-[chloro-(2,4,6-trifluorophenyl)methyl]-1-benzothiophene?
7-bromo-3-[chloro-(2,4,6-trifluorophenyl)methyl]-1-benzothiophene has a molecular weight of 391.64 g/mol, XLogP of 6.41, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-3-[chloro-(2,4,6-trifluorophenyl)methyl]-1-benzothiophene is sourced from PubChem (CID 81129145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).