C13H18BrNO2S — CID 81129209
[3-(2-bromoethyl)piperidin-1-yl]-(3-methoxythiophen-2-yl)methanone (PubChem CID 81129209) has the molecular formula C13H18BrNO2S and a molecular weight of 332.26 g/mol. Its IUPAC name is [3-(2-bromoethyl)piperidin-1-yl]-(3-methoxythiophen-2-yl)methanone.
| Compound Name | [3-(2-bromoethyl)piperidin-1-yl]-(3-methoxythiophen-2-yl)methanone |
|---|---|
| PubChem CID | 81129209 |
| Molecular Formula | C13H18BrNO2S |
| Molecular Weight | 332.26 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | [3-(2-bromoethyl)piperidin-1-yl]-(3-methoxythiophen-2-yl)methanone |
| SMILES | COc1ccsc1C(=O)N1CCCC(CCBr)C1 |
| InChI | InChI=1S/C13H18BrNO2S/c1-17-11-5-8-18-12(11)13(16)15-7-2-3-10(9-15)4-6-14/h5,8,10H,2-4,6-7,9H2,1H3 |
| InChIKey | FCSXNNCJRQOSNC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.26 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|