C14H28N2O3 — CID 81130459
4-[[(4-propan-2-ylmorpholin-2-yl)methylamino]methyl]oxan-4-ol (PubChem CID 81130459) has the molecular formula C14H28N2O3 and a molecular weight of 272.39 g/mol. Its IUPAC name is 4-[[(4-propan-2-ylmorpholin-2-yl)methylamino]methyl]oxan-4-ol.
| Compound Name | 4-[[(4-propan-2-ylmorpholin-2-yl)methylamino]methyl]oxan-4-ol |
|---|---|
| PubChem CID | 81130459 |
| Molecular Formula | C14H28N2O3 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | 4-[[(4-propan-2-ylmorpholin-2-yl)methylamino]methyl]oxan-4-ol |
| SMILES | CC(C)N1CCOC(CNCC2(O)CCOCC2)C1 |
| InChI | InChI=1S/C14H28N2O3/c1-12(2)16-5-8-19-13(10-16)9-15-11-14(17)3-6-18-7-4-14/h12-13,15,17H,3-11H2,1-2H3 |
| InChIKey | YLPUWIDHBISXNK-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |