About 4-[[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]methyl]oxan-4-ol
4-[[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]methyl]oxan-4-ol (PubChem CID 81130479) has the molecular formula C12H21N3O2S
and a molecular weight of 271.39 g/mol. Its IUPAC name is 4-[[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]methyl]oxan-4-ol.
Molecular Properties
| Compound Name | 4-[[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]methyl]oxan-4-ol |
| PubChem CID | 81130479 |
| Molecular Formula | C12H21N3O2S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 4-[[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]methyl]oxan-4-ol |
| SMILES | CC(C)(C)c1nsc(NCC2(O)CCOCC2)n1 |
| InChI | InChI=1S/C12H21N3O2S/c1-11(2,3)9-14-10(18-15-9)13-8-12(16)4-6-17-7-5-12/h16H,4-8H2,1-3H3,(H,13,14,15) |
| InChIKey | RFBZZGAWFAGIFA-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]methyl]oxan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]methyl]oxan-4-ol?
The IUPAC name of 4-[[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]methyl]oxan-4-ol (CID 81130479) is 4-[[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]methyl]oxan-4-ol.
What is the SMILES notation for 4-[[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]methyl]oxan-4-ol?
The canonical SMILES for 4-[[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]methyl]oxan-4-ol is CC(C)(C)c1nsc(NCC2(O)CCOCC2)n1.
What is the InChIKey of 4-[[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]methyl]oxan-4-ol?
The InChIKey is RFBZZGAWFAGIFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3O2S/c1-11(2,3)9-14-10(18-15-9)13-8-12(16)4-6-17-7-5-12/h16H,4-8H2,1-3H3,(H,13,14,15).
What are the key properties of 4-[[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]methyl]oxan-4-ol?
4-[[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]methyl]oxan-4-ol has a molecular weight of 271.39 g/mol, XLogP of 1.79, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]methyl]oxan-4-ol is sourced from PubChem (CID 81130479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).