C11H20N2O2 — CID 81130703
4-[(2,3,4,5-tetrahydropyridin-6-ylamino)methyl]oxan-4-ol (PubChem CID 81130703) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is 4-[(2,3,4,5-tetrahydropyridin-6-ylamino)methyl]oxan-4-ol.
| Compound Name | 4-[(2,3,4,5-tetrahydropyridin-6-ylamino)methyl]oxan-4-ol |
|---|---|
| PubChem CID | 81130703 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | 4-[(2,3,4,5-tetrahydropyridin-6-ylamino)methyl]oxan-4-ol |
| SMILES | OC1(CNC2=NCCCC2)CCOCC1 |
| InChI | InChI=1S/C11H20N2O2/c14-11(4-7-15-8-5-11)9-13-10-3-1-2-6-12-10/h14H,1-9H2,(H,12,13) |
| InChIKey | TWBRIIPALVYZNB-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |