About 4-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxan-4-ol
4-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxan-4-ol (PubChem CID 81130953) has the molecular formula C9H16F3NO3
and a molecular weight of 243.22 g/mol. Its IUPAC name is 4-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxan-4-ol.
Molecular Properties
| Compound Name | 4-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxan-4-ol |
| PubChem CID | 81130953 |
| Molecular Formula | C9H16F3NO3 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 4-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxan-4-ol |
| SMILES | OC(CNCC1(O)CCOCC1)C(F)(F)F |
| InChI | InChI=1S/C9H16F3NO3/c10-9(11,12)7(14)5-13-6-8(15)1-3-16-4-2-8/h7,13-15H,1-6H2 |
| InChIKey | DZZFJHUWUDCJTG-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxan-4-ol?
The IUPAC name of 4-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxan-4-ol (CID 81130953) is 4-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxan-4-ol.
What is the SMILES notation for 4-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxan-4-ol?
The canonical SMILES for 4-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxan-4-ol is OC(CNCC1(O)CCOCC1)C(F)(F)F.
What is the InChIKey of 4-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxan-4-ol?
The InChIKey is DZZFJHUWUDCJTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F3NO3/c10-9(11,12)7(14)5-13-6-8(15)1-3-16-4-2-8/h7,13-15H,1-6H2.
What are the key properties of 4-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxan-4-ol?
4-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxan-4-ol has a molecular weight of 243.22 g/mol, XLogP of 0.04, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxan-4-ol is sourced from PubChem (CID 81130953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).