About 2-N,6-dimethyl-2-N-(2-methylcyclohexyl)pyridine-2,3-diamine
2-N,6-dimethyl-2-N-(2-methylcyclohexyl)pyridine-2,3-diamine (PubChem CID 81131626) has the molecular formula C14H23N3
and a molecular weight of 233.36 g/mol. Its IUPAC name is 2-N,6-dimethyl-2-N-(2-methylcyclohexyl)pyridine-2,3-diamine.
Molecular Properties
| Compound Name | 2-N,6-dimethyl-2-N-(2-methylcyclohexyl)pyridine-2,3-diamine |
| PubChem CID | 81131626 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 2-N,6-dimethyl-2-N-(2-methylcyclohexyl)pyridine-2,3-diamine |
| SMILES | Cc1ccc(N)c(N(C)C2CCCCC2C)n1 |
| InChI | InChI=1S/C14H23N3/c1-10-6-4-5-7-13(10)17(3)14-12(15)9-8-11(2)16-14/h8-10,13H,4-7,15H2,1-3H3 |
| InChIKey | WAOCWLGUPHGIKK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-N,6-dimethyl-2-N-(2-methylcyclohexyl)pyridine-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,6-dimethyl-2-N-(2-methylcyclohexyl)pyridine-2,3-diamine?
The IUPAC name of 2-N,6-dimethyl-2-N-(2-methylcyclohexyl)pyridine-2,3-diamine (CID 81131626) is 2-N,6-dimethyl-2-N-(2-methylcyclohexyl)pyridine-2,3-diamine.
What is the SMILES notation for 2-N,6-dimethyl-2-N-(2-methylcyclohexyl)pyridine-2,3-diamine?
The canonical SMILES for 2-N,6-dimethyl-2-N-(2-methylcyclohexyl)pyridine-2,3-diamine is Cc1ccc(N)c(N(C)C2CCCCC2C)n1.
What is the InChIKey of 2-N,6-dimethyl-2-N-(2-methylcyclohexyl)pyridine-2,3-diamine?
The InChIKey is WAOCWLGUPHGIKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3/c1-10-6-4-5-7-13(10)17(3)14-12(15)9-8-11(2)16-14/h8-10,13H,4-7,15H2,1-3H3.
What are the key properties of 2-N,6-dimethyl-2-N-(2-methylcyclohexyl)pyridine-2,3-diamine?
2-N,6-dimethyl-2-N-(2-methylcyclohexyl)pyridine-2,3-diamine has a molecular weight of 233.36 g/mol, XLogP of 2.99, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,6-dimethyl-2-N-(2-methylcyclohexyl)pyridine-2,3-diamine is sourced from PubChem (CID 81131626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).