C9H15N3O2 — CID 81132463
2-[(3-amino-6-methyl-2-pyridinyl)amino]propane-1,3-diol (PubChem CID 81132463) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 2-[(3-amino-6-methyl-2-pyridinyl)amino]propane-1,3-diol.
| Compound Name | 2-[(3-amino-6-methyl-2-pyridinyl)amino]propane-1,3-diol |
|---|---|
| PubChem CID | 81132463 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 2-[(3-amino-6-methyl-2-pyridinyl)amino]propane-1,3-diol |
| SMILES | Cc1ccc(N)c(NC(CO)CO)n1 |
| InChI | InChI=1S/C9H15N3O2/c1-6-2-3-8(10)9(11-6)12-7(4-13)5-14/h2-3,7,13-14H,4-5,10H2,1H3,(H,11,12) |
| InChIKey | VOPXGBSXFHFRLG-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |