C9H12F3N3 — CID 81132933
6-methyl-2-N-(3,3,3-trifluoropropyl)pyridine-2,3-diamine (PubChem CID 81132933) has the molecular formula C9H12F3N3 and a molecular weight of 219.21 g/mol. Its IUPAC name is 6-methyl-2-N-(3,3,3-trifluoropropyl)pyridine-2,3-diamine.
| Compound Name | 6-methyl-2-N-(3,3,3-trifluoropropyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 81132933 |
| Molecular Formula | C9H12F3N3 |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 6-methyl-2-N-(3,3,3-trifluoropropyl)pyridine-2,3-diamine |
| SMILES | Cc1ccc(N)c(NCCC(F)(F)F)n1 |
| InChI | InChI=1S/C9H12F3N3/c1-6-2-3-7(13)8(15-6)14-5-4-9(10,11)12/h2-3H,4-5,13H2,1H3,(H,14,15) |
| InChIKey | OWEXHUURGSUCCG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |