C12H16N2O6S — CID 81133465
N-[(4-hydroxyoxan-4-yl)methyl]-3-nitrobenzenesulfonamide (PubChem CID 81133465) has the molecular formula C12H16N2O6S and a molecular weight of 316.33 g/mol. Its IUPAC name is N-[(4-hydroxyoxan-4-yl)methyl]-3-nitrobenzenesulfonamide.
| Compound Name | N-[(4-hydroxyoxan-4-yl)methyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 81133465 |
| Molecular Formula | C12H16N2O6S |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | N-[(4-hydroxyoxan-4-yl)methyl]-3-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1cccc(S(=O)(=O)NCC2(O)CCOCC2)c1 |
| InChI | InChI=1S/C12H16N2O6S/c15-12(4-6-20-7-5-12)9-13-21(18,19)11-3-1-2-10(8-11)14(16)17/h1-3,8,13,15H,4-7,9H2 |
| InChIKey | RJZOSPWTUQVBSL-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|