C15H26N2O2 — CID 81134021
2-[4-(dimethylamino)butan-2-ylamino]-1-(3-methoxyphenyl)ethanol (PubChem CID 81134021) has the molecular formula C15H26N2O2 and a molecular weight of 266.39 g/mol. Its IUPAC name is 2-[4-(dimethylamino)butan-2-ylamino]-1-(3-methoxyphenyl)ethanol.
| Compound Name | 2-[4-(dimethylamino)butan-2-ylamino]-1-(3-methoxyphenyl)ethanol |
|---|---|
| PubChem CID | 81134021 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 2-[4-(dimethylamino)butan-2-ylamino]-1-(3-methoxyphenyl)ethanol |
| SMILES | COc1cccc(C(O)CNC(C)CCN(C)C)c1 |
| InChI | InChI=1S/C15H26N2O2/c1-12(8-9-17(2)3)16-11-15(18)13-6-5-7-14(10-13)19-4/h5-7,10,12,15-16,18H,8-9,11H2,1-4H3 |
| InChIKey | MFMNAWQPHCPUNU-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |