C9H16N2O2 — CID 81134235
(3S)-N-(oxetan-3-yl)piperidine-3-carboxamide (PubChem CID 81134235) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is (3S)-N-(oxetan-3-yl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-(oxetan-3-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 81134235 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | (3S)-N-(oxetan-3-yl)piperidine-3-carboxamide |
| SMILES | O=C(NC1COC1)[C@H]1CCCNC1 |
| InChI | InChI=1S/C9H16N2O2/c12-9(11-8-5-13-6-8)7-2-1-3-10-4-7/h7-8,10H,1-6H2,(H,11,12)/t7-/m0/s1 |
| InChIKey | ISUJIESGVJSOJK-ZETCQYMHSA-N |
| XLogP | -0.50 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |