C14H26N2O — CID 81134931
(3R)-N-(2-methylcycloheptyl)piperidine-3-carboxamide (PubChem CID 81134931) has the molecular formula C14H26N2O and a molecular weight of 238.37 g/mol. Its IUPAC name is (3R)-N-(2-methylcycloheptyl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-(2-methylcycloheptyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 81134931 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | (3R)-N-(2-methylcycloheptyl)piperidine-3-carboxamide |
| SMILES | CC1CCCCCC1NC(=O)[C@@H]1CCCNC1 |
| InChI | InChI=1S/C14H26N2O/c1-11-6-3-2-4-8-13(11)16-14(17)12-7-5-9-15-10-12/h11-13,15H,2-10H2,1H3,(H,16,17)/t11?,12-,13?/m1/s1 |
| InChIKey | LNBAQRUAWNVDRY-OTTFEQOBSA-N |
| XLogP | 2.07 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |