C13H19N5O2S — CID 81135186
1-(3-methoxyphenyl)-2-[1-[2-(methylamino)ethyl]tetrazol-5-yl]sulfanylethanol (PubChem CID 81135186) has the molecular formula C13H19N5O2S and a molecular weight of 309.40 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-2-[1-[2-(methylamino)ethyl]tetrazol-5-yl]sulfanylethanol.
| Compound Name | 1-(3-methoxyphenyl)-2-[1-[2-(methylamino)ethyl]tetrazol-5-yl]sulfanylethanol |
|---|---|
| PubChem CID | 81135186 |
| Molecular Formula | C13H19N5O2S |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 1-(3-methoxyphenyl)-2-[1-[2-(methylamino)ethyl]tetrazol-5-yl]sulfanylethanol |
| SMILES | CNCCn1nnnc1SCC(O)c1cccc(OC)c1 |
| InChI | InChI=1S/C13H19N5O2S/c1-14-6-7-18-13(15-16-17-18)21-9-12(19)10-4-3-5-11(8-10)20-2/h3-5,8,12,14,19H,6-7,9H2,1-2H3 |
| InChIKey | QOJDXIGUZAQOJU-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |