C11H14N6O2 — CID 81136342
N-[(5-amino-1-methylpyrazol-4-yl)methyl]-6-methyl-3-nitropyridin-2-amine (PubChem CID 81136342) has the molecular formula C11H14N6O2 and a molecular weight of 262.27 g/mol. Its IUPAC name is N-[(5-amino-1-methylpyrazol-4-yl)methyl]-6-methyl-3-nitropyridin-2-amine.
| Compound Name | N-[(5-amino-1-methylpyrazol-4-yl)methyl]-6-methyl-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 81136342 |
| Molecular Formula | C11H14N6O2 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | N-[(5-amino-1-methylpyrazol-4-yl)methyl]-6-methyl-3-nitropyridin-2-amine |
| SMILES | Cc1ccc([N+](=O)[O-])c(NCc2cnn(C)c2N)n1 |
| InChI | InChI=1S/C11H14N6O2/c1-7-3-4-9(17(18)19)11(15-7)13-5-8-6-14-16(2)10(8)12/h3-4,6H,5,12H2,1-2H3,(H,13,15) |
| InChIKey | RPPZUZYMPSLJCJ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|