C16H24N4 — CID 81136422
5-methyl-3-(4-propylcyclohexyl)imidazo[4,5-b]pyridin-2-amine (PubChem CID 81136422) has the molecular formula C16H24N4 and a molecular weight of 272.40 g/mol. Its IUPAC name is 5-methyl-3-(4-propylcyclohexyl)imidazo[4,5-b]pyridin-2-amine.
| Compound Name | 5-methyl-3-(4-propylcyclohexyl)imidazo[4,5-b]pyridin-2-amine |
|---|---|
| PubChem CID | 81136422 |
| Molecular Formula | C16H24N4 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | 5-methyl-3-(4-propylcyclohexyl)imidazo[4,5-b]pyridin-2-amine |
| SMILES | CCCC1CCC(n2c(N)nc3ccc(C)nc32)CC1 |
| InChI | InChI=1S/C16H24N4/c1-3-4-12-6-8-13(9-7-12)20-15-14(19-16(20)17)10-5-11(2)18-15/h5,10,12-13H,3-4,6-9H2,1-2H3,(H2,17,19) |
| InChIKey | BEKHBASEMHSASS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |