About 4-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)-1,3-thiazol-2-amine
4-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)-1,3-thiazol-2-amine (PubChem CID 81136804) has the molecular formula C10H9N5S
and a molecular weight of 231.28 g/mol. Its IUPAC name is 4-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)-1,3-thiazol-2-amine |
| PubChem CID | 81136804 |
| Molecular Formula | C10H9N5S |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 4-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)-1,3-thiazol-2-amine |
| SMILES | Cc1ccc2[nH]c(-c3csc(N)n3)nc2n1 |
| InChI | InChI=1S/C10H9N5S/c1-5-2-3-6-8(12-5)15-9(13-6)7-4-16-10(11)14-7/h2-4H,1H3,(H2,11,14)(H,12,13,15) |
| InChIKey | UYQLLGVDLDKTSM-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)-1,3-thiazol-2-amine?
The IUPAC name of 4-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)-1,3-thiazol-2-amine (CID 81136804) is 4-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)-1,3-thiazol-2-amine.
What is the SMILES notation for 4-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)-1,3-thiazol-2-amine?
The canonical SMILES for 4-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)-1,3-thiazol-2-amine is Cc1ccc2[nH]c(-c3csc(N)n3)nc2n1.
What is the InChIKey of 4-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)-1,3-thiazol-2-amine?
The InChIKey is UYQLLGVDLDKTSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N5S/c1-5-2-3-6-8(12-5)15-9(13-6)7-4-16-10(11)14-7/h2-4H,1H3,(H2,11,14)(H,12,13,15).
What are the key properties of 4-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)-1,3-thiazol-2-amine?
4-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)-1,3-thiazol-2-amine has a molecular weight of 231.28 g/mol, XLogP of 1.97, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)-1,3-thiazol-2-amine is sourced from PubChem (CID 81136804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).